About [(Z)-[(3aR,7aR)-7a-methyl-5-oxo-3a,4-dihydro-1-benzofuran-3-ylidene]-phenylmethyl] acetate
[(Z)-[(3aR,7aR)-7a-methyl-5-oxo-3a,4-dihydro-1-benzofuran-3-ylidene]-phenylmethyl] acetate (PubChem CID 70697490) has the molecular formula C18H18O4
and a molecular weight of 298.34 g/mol. Its IUPAC name is [(Z)-[(3aR,7aR)-7a-methyl-5-oxo-3a,4-dihydro-1-benzofuran-3-ylidene]-phenylmethyl] acetate.
Molecular Properties
| Compound Name | [(Z)-[(3aR,7aR)-7a-methyl-5-oxo-3a,4-dihydro-1-benzofuran-3-ylidene]-phenylmethyl] acetate |
| PubChem CID | 70697490 |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | [(Z)-[(3aR,7aR)-7a-methyl-5-oxo-3a,4-dihydro-1-benzofuran-3-ylidene]-phenylmethyl] acetate |
| SMILES | CC(=O)O/C(=C1\CO[C@]2(C)C=CC(=O)C[C@H]12)c1ccccc1 |
| InChI | InChI=1S/C18H18O4/c1-12(19)22-17(13-6-4-3-5-7-13)15-11-21-18(2)9-8-14(20)10-16(15)18/h3-9,16H,10-11H2,1-2H3/b17-15+/t16-,18-/m1/s1 |
| InChIKey | YSSLTZMNJYIUEZ-RDBNGCDTSA-N |
| XLogP | 2.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-[(3aR,7aR)-7a-methyl-5-oxo-3a,4-dihydro-1-benzofuran-3-ylidene]-phenylmethyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-[(3aR,7aR)-7a-methyl-5-oxo-3a,4-dihydro-1-benzofuran-3-ylidene]-phenylmethyl] acetate?
The IUPAC name of [(Z)-[(3aR,7aR)-7a-methyl-5-oxo-3a,4-dihydro-1-benzofuran-3-ylidene]-phenylmethyl] acetate (CID 70697490) is [(Z)-[(3aR,7aR)-7a-methyl-5-oxo-3a,4-dihydro-1-benzofuran-3-ylidene]-phenylmethyl] acetate.
What is the SMILES notation for [(Z)-[(3aR,7aR)-7a-methyl-5-oxo-3a,4-dihydro-1-benzofuran-3-ylidene]-phenylmethyl] acetate?
The canonical SMILES for [(Z)-[(3aR,7aR)-7a-methyl-5-oxo-3a,4-dihydro-1-benzofuran-3-ylidene]-phenylmethyl] acetate is CC(=O)O/C(=C1\CO[C@]2(C)C=CC(=O)C[C@H]12)c1ccccc1.
What is the InChIKey of [(Z)-[(3aR,7aR)-7a-methyl-5-oxo-3a,4-dihydro-1-benzofuran-3-ylidene]-phenylmethyl] acetate?
The InChIKey is YSSLTZMNJYIUEZ-RDBNGCDTSA-N. The full InChI is InChI=1S/C18H18O4/c1-12(19)22-17(13-6-4-3-5-7-13)15-11-21-18(2)9-8-14(20)10-16(15)18/h3-9,16H,10-11H2,1-2H3/b17-15+/t16-,18-/m1/s1.
What are the key properties of [(Z)-[(3aR,7aR)-7a-methyl-5-oxo-3a,4-dihydro-1-benzofuran-3-ylidene]-phenylmethyl] acetate?
[(Z)-[(3aR,7aR)-7a-methyl-5-oxo-3a,4-dihydro-1-benzofuran-3-ylidene]-phenylmethyl] acetate has a molecular weight of 298.34 g/mol, XLogP of 2.89, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-[(3aR,7aR)-7a-methyl-5-oxo-3a,4-dihydro-1-benzofuran-3-ylidene]-phenylmethyl] acetate is sourced from PubChem (CID 70697490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).