About 1-[(2R)-3,3-dimethylbutan-2-yl]-3-pyridin-4-ylthiourea;hydrochloride
1-[(2R)-3,3-dimethylbutan-2-yl]-3-pyridin-4-ylthiourea;hydrochloride (PubChem CID 70697539) has the molecular formula C12H20ClN3S
and a molecular weight of 273.83 g/mol. Its IUPAC name is 1-[(2R)-3,3-dimethylbutan-2-yl]-3-pyridin-4-ylthiourea;hydrochloride.
Molecular Properties
| Compound Name | 1-[(2R)-3,3-dimethylbutan-2-yl]-3-pyridin-4-ylthiourea;hydrochloride |
| PubChem CID | 70697539 |
| Molecular Formula | C12H20ClN3S |
| Molecular Weight | 273.83 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 1-[(2R)-3,3-dimethylbutan-2-yl]-3-pyridin-4-ylthiourea;hydrochloride |
| SMILES | C[C@@H](NC(=S)Nc1ccncc1)C(C)(C)C.Cl |
| InChI | InChI=1S/C12H19N3S.ClH/c1-9(12(2,3)4)14-11(16)15-10-5-7-13-8-6-10;/h5-9H,1-4H3,(H2,13,14,15,16);1H/t9-;/m1./s1 |
| InChIKey | IKUZOAMPJFXADT-SBSPUUFOSA-N |
| XLogP | 3.22 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.83 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2R)-3,3-dimethylbutan-2-yl]-3-pyridin-4-ylthiourea;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2R)-3,3-dimethylbutan-2-yl]-3-pyridin-4-ylthiourea;hydrochloride?
The IUPAC name of 1-[(2R)-3,3-dimethylbutan-2-yl]-3-pyridin-4-ylthiourea;hydrochloride (CID 70697539) is 1-[(2R)-3,3-dimethylbutan-2-yl]-3-pyridin-4-ylthiourea;hydrochloride.
What is the SMILES notation for 1-[(2R)-3,3-dimethylbutan-2-yl]-3-pyridin-4-ylthiourea;hydrochloride?
The canonical SMILES for 1-[(2R)-3,3-dimethylbutan-2-yl]-3-pyridin-4-ylthiourea;hydrochloride is C[C@@H](NC(=S)Nc1ccncc1)C(C)(C)C.Cl.
What is the InChIKey of 1-[(2R)-3,3-dimethylbutan-2-yl]-3-pyridin-4-ylthiourea;hydrochloride?
The InChIKey is IKUZOAMPJFXADT-SBSPUUFOSA-N. The full InChI is InChI=1S/C12H19N3S.ClH/c1-9(12(2,3)4)14-11(16)15-10-5-7-13-8-6-10;/h5-9H,1-4H3,(H2,13,14,15,16);1H/t9-;/m1./s1.
What are the key properties of 1-[(2R)-3,3-dimethylbutan-2-yl]-3-pyridin-4-ylthiourea;hydrochloride?
1-[(2R)-3,3-dimethylbutan-2-yl]-3-pyridin-4-ylthiourea;hydrochloride has a molecular weight of 273.83 g/mol, XLogP of 3.22, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2R)-3,3-dimethylbutan-2-yl]-3-pyridin-4-ylthiourea;hydrochloride is sourced from PubChem (CID 70697539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).