C20H26O2 — CID 70698064
(4Z,6Z,10E,13R)-7,11-dimethyl-4-prop-1-en-2-yl-14-oxabicyclo[11.2.1]hexadeca-1(16),4,6,10-tetraen-15-one (PubChem CID 70698064) has the molecular formula C20H26O2 and a molecular weight of 298.43 g/mol. Its IUPAC name is (4Z,6Z,10E,13R)-7,11-dimethyl-4-prop-1-en-2-yl-14-oxabicyclo[11.2.1]hexadeca-1(16),4,6,10-tetraen-15-one.
| Compound Name | (4Z,6Z,10E,13R)-7,11-dimethyl-4-prop-1-en-2-yl-14-oxabicyclo[11.2.1]hexadeca-1(16),4,6,10-tetraen-15-one |
|---|---|
| PubChem CID | 70698064 |
| Molecular Formula | C20H26O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | (4Z,6Z,10E,13R)-7,11-dimethyl-4-prop-1-en-2-yl-14-oxabicyclo[11.2.1]hexadeca-1(16),4,6,10-tetraen-15-one |
| SMILES | C=C(C)/C1=C\C=C(\C)CC/C=C(\C)C[C@@H]2C=C(CC1)C(=O)O2 |
| InChI | InChI=1S/C20H26O2/c1-14(2)17-9-8-15(3)6-5-7-16(4)12-19-13-18(11-10-17)20(21)22-19/h7-9,13,19H,1,5-6,10-12H2,2-4H3/b15-8-,16-7+,17-9-/t19-/m1/s1 |
| InChIKey | KGUUUDYKWYRRMZ-VIQXUYFPSA-N |
| XLogP | 5.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|