About 2-methyl-6-pentadecyl-2,3,4,5-tetrahydropyridine
2-methyl-6-pentadecyl-2,3,4,5-tetrahydropyridine (PubChem CID 70698157) has the molecular formula C21H41N
and a molecular weight of 307.57 g/mol. Its IUPAC name is 2-methyl-6-pentadecyl-2,3,4,5-tetrahydropyridine.
Molecular Properties
| Compound Name | 2-methyl-6-pentadecyl-2,3,4,5-tetrahydropyridine |
| PubChem CID | 70698157 |
| Molecular Formula | C21H41N |
| Molecular Weight | 307.57 g/mol |
| Exact Mass | 307.32 |
| IUPAC Name | 2-methyl-6-pentadecyl-2,3,4,5-tetrahydropyridine |
| SMILES | CCCCCCCCCCCCCCCC1=NC(C)CCC1 |
| InChI | InChI=1S/C21H41N/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-18-21-19-16-17-20(2)22-21/h20H,3-19H2,1-2H3 |
| InChIKey | YMZAXCVACZXRMD-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 307.57 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-6-pentadecyl-2,3,4,5-tetrahydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6-pentadecyl-2,3,4,5-tetrahydropyridine?
The IUPAC name of 2-methyl-6-pentadecyl-2,3,4,5-tetrahydropyridine (CID 70698157) is 2-methyl-6-pentadecyl-2,3,4,5-tetrahydropyridine.
What is the SMILES notation for 2-methyl-6-pentadecyl-2,3,4,5-tetrahydropyridine?
The canonical SMILES for 2-methyl-6-pentadecyl-2,3,4,5-tetrahydropyridine is CCCCCCCCCCCCCCCC1=NC(C)CCC1.
What is the InChIKey of 2-methyl-6-pentadecyl-2,3,4,5-tetrahydropyridine?
The InChIKey is YMZAXCVACZXRMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H41N/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-18-21-19-16-17-20(2)22-21/h20H,3-19H2,1-2H3.
What are the key properties of 2-methyl-6-pentadecyl-2,3,4,5-tetrahydropyridine?
2-methyl-6-pentadecyl-2,3,4,5-tetrahydropyridine has a molecular weight of 307.57 g/mol, XLogP of 7.48, 14 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6-pentadecyl-2,3,4,5-tetrahydropyridine is sourced from PubChem (CID 70698157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).