C24H24N4O2S2 — CID 70698491
(1R,4S,7S,9S)-9-(1H-indol-3-yl)-5-methyl-4,7-bis(methylsulfanyl)-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-triene-3,6-dione (PubChem CID 70698491) has the molecular formula C24H24N4O2S2 and a molecular weight of 464.62 g/mol. Its IUPAC name is (1R,4S,7S,9S)-9-(1H-indol-3-yl)-5-methyl-4,7-bis(methylsulfanyl)-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-triene-3,6-dione.
| Compound Name | (1R,4S,7S,9S)-9-(1H-indol-3-yl)-5-methyl-4,7-bis(methylsulfanyl)-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-triene-3,6-dione |
|---|---|
| PubChem CID | 70698491 |
| Molecular Formula | C24H24N4O2S2 |
| Molecular Weight | 464.62 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | (1R,4S,7S,9S)-9-(1H-indol-3-yl)-5-methyl-4,7-bis(methylsulfanyl)-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-triene-3,6-dione |
| SMILES | CS[C@H]1C(=O)N2[C@H]3Nc4ccccc4[C@@]3(c3c[nH]c4ccccc34)C[C@]2(SC)C(=O)N1C |
| InChI | InChI=1S/C24H24N4O2S2/c1-27-20(31-2)19(29)28-21-23(13-24(28,32-3)22(27)30,15-9-5-7-11-18(15)26-21)16-12-25-17-10-6-4-8-14(16)17/h4-12,20-21,25-26H,13H2,1-3H3/t20-,21+,23+,24-/m0/s1 |
| InChIKey | LIFASPWDCJIPIM-SCDRESIJSA-N |
| XLogP | 3.66 |
| TPSA | 68.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.62 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |