C13H26N2O — CID 70698497
1-[(2R,5S)-2,4,5-trimethylpiperazin-1-yl]hexan-1-one (PubChem CID 70698497) has the molecular formula C13H26N2O and a molecular weight of 226.36 g/mol. Its IUPAC name is 1-[(2R,5S)-2,4,5-trimethylpiperazin-1-yl]hexan-1-one.
| Compound Name | 1-[(2R,5S)-2,4,5-trimethylpiperazin-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 70698497 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | 1-[(2R,5S)-2,4,5-trimethylpiperazin-1-yl]hexan-1-one |
| SMILES | CCCCCC(=O)N1C[C@H](C)N(C)C[C@H]1C |
| InChI | InChI=1S/C13H26N2O/c1-5-6-7-8-13(16)15-10-11(2)14(4)9-12(15)3/h11-12H,5-10H2,1-4H3/t11-,12+/m0/s1 |
| InChIKey | QSVVIHKUSYIAGZ-NWDGAFQWSA-N |
| XLogP | 2.12 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|