C31H37NO6 — CID 70698511
2-O-tert-butyl 6-O,8-O-dimethyl (2R,3S,5R,6R,8S)-6-methyl-3-phenyl-5-[(E)-2-phenylethenyl]-2,3,5,7-tetrahydro-1H-pyrrolizine-2,6,8-tricarboxylate (PubChem CID 70698511) has the molecular formula C31H37NO6 and a molecular weight of 519.64 g/mol. Its IUPAC name is 2-O-tert-butyl 6-O,8-O-dimethyl (2R,3S,5R,6R,8S)-6-methyl-3-phenyl-5-[(E)-2-phenylethenyl]-2,3,5,7-tetrahydro-1H-pyrrolizine-2,6,8-tricarboxylate.
| Compound Name | 2-O-tert-butyl 6-O,8-O-dimethyl (2R,3S,5R,6R,8S)-6-methyl-3-phenyl-5-[(E)-2-phenylethenyl]-2,3,5,7-tetrahydro-1H-pyrrolizine-2,6,8-tricarboxylate |
|---|---|
| PubChem CID | 70698511 |
| Molecular Formula | C31H37NO6 |
| Molecular Weight | 519.64 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | 2-O-tert-butyl 6-O,8-O-dimethyl (2R,3S,5R,6R,8S)-6-methyl-3-phenyl-5-[(E)-2-phenylethenyl]-2,3,5,7-tetrahydro-1H-pyrrolizine-2,6,8-tricarboxylate |
| SMILES | COC(=O)[C@@]12C[C@@H](C(=O)OC(C)(C)C)[C@@H](c3ccccc3)N1[C@H](/C=C/c1ccccc1)[C@](C)(C(=O)OC)C2 |
| InChI | InChI=1S/C31H37NO6/c1-29(2,3)38-26(33)23-19-31(28(35)37-6)20-30(4,27(34)36-5)24(18-17-21-13-9-7-10-14-21)32(31)25(23)22-15-11-8-12-16-22/h7-18,23-25H,19-20H2,1-6H3/b18-17+/t23-,24-,25-,30-,31+/m1/s1 |
| InChIKey | SOJCGAUJYDRYMS-YZAIQWEFSA-N |
| XLogP | 4.97 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.64 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|