C34H36N2O6 — CID 70698512
2-O-tert-butyl 8-O-methyl (2R,3S,5R,6R,7R,8S)-6-nitro-3,7-diphenyl-5-[(E)-2-phenylethenyl]-1,2,3,5,6,7-hexahydropyrrolizine-2,8-dicarboxylate (PubChem CID 70698512) has the molecular formula C34H36N2O6 and a molecular weight of 568.67 g/mol. Its IUPAC name is 2-O-tert-butyl 8-O-methyl (2R,3S,5R,6R,7R,8S)-6-nitro-3,7-diphenyl-5-[(E)-2-phenylethenyl]-1,2,3,5,6,7-hexahydropyrrolizine-2,8-dicarboxylate.
| Compound Name | 2-O-tert-butyl 8-O-methyl (2R,3S,5R,6R,7R,8S)-6-nitro-3,7-diphenyl-5-[(E)-2-phenylethenyl]-1,2,3,5,6,7-hexahydropyrrolizine-2,8-dicarboxylate |
|---|---|
| PubChem CID | 70698512 |
| Molecular Formula | C34H36N2O6 |
| Molecular Weight | 568.67 g/mol |
| Exact Mass | 568.26 |
| IUPAC Name | 2-O-tert-butyl 8-O-methyl (2R,3S,5R,6R,7R,8S)-6-nitro-3,7-diphenyl-5-[(E)-2-phenylethenyl]-1,2,3,5,6,7-hexahydropyrrolizine-2,8-dicarboxylate |
| SMILES | COC(=O)[C@@]12C[C@@H](C(=O)OC(C)(C)C)[C@@H](c3ccccc3)N1[C@H](/C=C/c1ccccc1)[C@H]([N+](=O)[O-])[C@H]2c1ccccc1 |
| InChI | InChI=1S/C34H36N2O6/c1-33(2,3)42-31(37)26-22-34(32(38)41-4)28(24-16-10-6-11-17-24)30(36(39)40)27(21-20-23-14-8-5-9-15-23)35(34)29(26)25-18-12-7-13-19-25/h5-21,26-30H,22H2,1-4H3/b21-20+/t26-,27-,28-,29-,30+,34+/m1/s1 |
| InChIKey | VSTCZMDJNFVKPW-RYBGWGPCSA-N |
| XLogP | 5.83 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.67 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|