About 6-methyl-1-[(2-methylphenyl)diazenyl]cyclohexa-2,4-dien-1-amine;hydrochloride
6-methyl-1-[(2-methylphenyl)diazenyl]cyclohexa-2,4-dien-1-amine;hydrochloride (PubChem CID 70700010) has the molecular formula C14H18ClN3
and a molecular weight of 263.77 g/mol. Its IUPAC name is 6-methyl-1-[(2-methylphenyl)diazenyl]cyclohexa-2,4-dien-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 6-methyl-1-[(2-methylphenyl)diazenyl]cyclohexa-2,4-dien-1-amine;hydrochloride |
| PubChem CID | 70700010 |
| Molecular Formula | C14H18ClN3 |
| Molecular Weight | 263.77 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 6-methyl-1-[(2-methylphenyl)diazenyl]cyclohexa-2,4-dien-1-amine;hydrochloride |
| SMILES | Cc1ccccc1/N=N/C1(N)C=CC=CC1C.Cl |
| InChI | InChI=1S/C14H17N3.ClH/c1-11-7-3-4-9-13(11)16-17-14(15)10-6-5-8-12(14)2;/h3-10,12H,15H2,1-2H3;1H/b17-16+; |
| InChIKey | FVZPWJSZGDAHLP-CMBBICFISA-N |
| XLogP | 3.92 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.77 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-1-[(2-methylphenyl)diazenyl]cyclohexa-2,4-dien-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-1-[(2-methylphenyl)diazenyl]cyclohexa-2,4-dien-1-amine;hydrochloride?
The IUPAC name of 6-methyl-1-[(2-methylphenyl)diazenyl]cyclohexa-2,4-dien-1-amine;hydrochloride (CID 70700010) is 6-methyl-1-[(2-methylphenyl)diazenyl]cyclohexa-2,4-dien-1-amine;hydrochloride.
What is the SMILES notation for 6-methyl-1-[(2-methylphenyl)diazenyl]cyclohexa-2,4-dien-1-amine;hydrochloride?
The canonical SMILES for 6-methyl-1-[(2-methylphenyl)diazenyl]cyclohexa-2,4-dien-1-amine;hydrochloride is Cc1ccccc1/N=N/C1(N)C=CC=CC1C.Cl.
What is the InChIKey of 6-methyl-1-[(2-methylphenyl)diazenyl]cyclohexa-2,4-dien-1-amine;hydrochloride?
The InChIKey is FVZPWJSZGDAHLP-CMBBICFISA-N. The full InChI is InChI=1S/C14H17N3.ClH/c1-11-7-3-4-9-13(11)16-17-14(15)10-6-5-8-12(14)2;/h3-10,12H,15H2,1-2H3;1H/b17-16+;.
What are the key properties of 6-methyl-1-[(2-methylphenyl)diazenyl]cyclohexa-2,4-dien-1-amine;hydrochloride?
6-methyl-1-[(2-methylphenyl)diazenyl]cyclohexa-2,4-dien-1-amine;hydrochloride has a molecular weight of 263.77 g/mol, XLogP of 3.92, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-1-[(2-methylphenyl)diazenyl]cyclohexa-2,4-dien-1-amine;hydrochloride is sourced from PubChem (CID 70700010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).