About 6-methylpyridine-3,4-diamine;dihydrochloride
6-methylpyridine-3,4-diamine;dihydrochloride (PubChem CID 70700317) has the molecular formula C6H11Cl2N3
and a molecular weight of 196.08 g/mol. Its IUPAC name is 6-methylpyridine-3,4-diamine;dihydrochloride.
Molecular Properties
| Compound Name | 6-methylpyridine-3,4-diamine;dihydrochloride |
| PubChem CID | 70700317 |
| Molecular Formula | C6H11Cl2N3 |
| Molecular Weight | 196.08 g/mol |
| Exact Mass | 195.03 |
| IUPAC Name | 6-methylpyridine-3,4-diamine;dihydrochloride |
| SMILES | Cc1cc(N)c(N)cn1.Cl.Cl |
| InChI | InChI=1S/C6H9N3.2ClH/c1-4-2-5(7)6(8)3-9-4;;/h2-3H,8H2,1H3,(H2,7,9);2*1H |
| InChIKey | JRQTXAVXNKCMPF-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.08 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-methylpyridine-3,4-diamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylpyridine-3,4-diamine;dihydrochloride?
The IUPAC name of 6-methylpyridine-3,4-diamine;dihydrochloride (CID 70700317) is 6-methylpyridine-3,4-diamine;dihydrochloride.
What is the SMILES notation for 6-methylpyridine-3,4-diamine;dihydrochloride?
The canonical SMILES for 6-methylpyridine-3,4-diamine;dihydrochloride is Cc1cc(N)c(N)cn1.Cl.Cl.
What is the InChIKey of 6-methylpyridine-3,4-diamine;dihydrochloride?
The InChIKey is JRQTXAVXNKCMPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3.2ClH/c1-4-2-5(7)6(8)3-9-4;;/h2-3H,8H2,1H3,(H2,7,9);2*1H.
What are the key properties of 6-methylpyridine-3,4-diamine;dihydrochloride?
6-methylpyridine-3,4-diamine;dihydrochloride has a molecular weight of 196.08 g/mol, XLogP of 1.40, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylpyridine-3,4-diamine;dihydrochloride is sourced from PubChem (CID 70700317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).