About 2-[2-(dioctylamino)-2-oxoethoxy]-N,N-dioctylacetamide
2-[2-(dioctylamino)-2-oxoethoxy]-N,N-dioctylacetamide (PubChem CID 70700400) has the molecular formula C36H72N2O3
and a molecular weight of 580.98 g/mol. Its IUPAC name is 2-[2-(dioctylamino)-2-oxoethoxy]-N,N-dioctylacetamide.
Molecular Properties
| Compound Name | 2-[2-(dioctylamino)-2-oxoethoxy]-N,N-dioctylacetamide |
| PubChem CID | 70700400 |
| Molecular Formula | C36H72N2O3 |
| Molecular Weight | 580.98 g/mol |
| Exact Mass | 580.55 |
| IUPAC Name | 2-[2-(dioctylamino)-2-oxoethoxy]-N,N-dioctylacetamide |
| SMILES | CCCCCCCCN(CCCCCCCC)C(=O)COCC(=O)N(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C36H72N2O3/c1-5-9-13-17-21-25-29-37(30-26-22-18-14-10-6-2)35(39)33-41-34-36(40)38(31-27-23-19-15-11-7-3)32-28-24-20-16-12-8-4/h5-34H2,1-4H3 |
| InChIKey | VRZYWIAVUGQHKB-UHFFFAOYSA-N |
| XLogP | 10.10 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 580.98 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(dioctylamino)-2-oxoethoxy]-N,N-dioctylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(dioctylamino)-2-oxoethoxy]-N,N-dioctylacetamide?
The IUPAC name of 2-[2-(dioctylamino)-2-oxoethoxy]-N,N-dioctylacetamide (CID 70700400) is 2-[2-(dioctylamino)-2-oxoethoxy]-N,N-dioctylacetamide.
What is the SMILES notation for 2-[2-(dioctylamino)-2-oxoethoxy]-N,N-dioctylacetamide?
The canonical SMILES for 2-[2-(dioctylamino)-2-oxoethoxy]-N,N-dioctylacetamide is CCCCCCCCN(CCCCCCCC)C(=O)COCC(=O)N(CCCCCCCC)CCCCCCCC.
What is the InChIKey of 2-[2-(dioctylamino)-2-oxoethoxy]-N,N-dioctylacetamide?
The InChIKey is VRZYWIAVUGQHKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H72N2O3/c1-5-9-13-17-21-25-29-37(30-26-22-18-14-10-6-2)35(39)33-41-34-36(40)38(31-27-23-19-15-11-7-3)32-28-24-20-16-12-8-4/h5-34H2,1-4H3.
What are the key properties of 2-[2-(dioctylamino)-2-oxoethoxy]-N,N-dioctylacetamide?
2-[2-(dioctylamino)-2-oxoethoxy]-N,N-dioctylacetamide has a molecular weight of 580.98 g/mol, XLogP of 10.10, 32 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(dioctylamino)-2-oxoethoxy]-N,N-dioctylacetamide is sourced from PubChem (CID 70700400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).