About 2-(bromomethyl)-3,3-diethoxypropanal
2-(bromomethyl)-3,3-diethoxypropanal (PubChem CID 70700528) has the molecular formula C8H15BrO3
and a molecular weight of 239.11 g/mol. Its IUPAC name is 2-(bromomethyl)-3,3-diethoxypropanal.
Molecular Properties
| Compound Name | 2-(bromomethyl)-3,3-diethoxypropanal |
| PubChem CID | 70700528 |
| Molecular Formula | C8H15BrO3 |
| Molecular Weight | 239.11 g/mol |
| Exact Mass | 238.02 |
| IUPAC Name | 2-(bromomethyl)-3,3-diethoxypropanal |
| SMILES | CCOC(OCC)C(C=O)CBr |
| InChI | InChI=1S/C8H15BrO3/c1-3-11-8(12-4-2)7(5-9)6-10/h6-8H,3-5H2,1-2H3 |
| InChIKey | SKCXVXRCRRNZPL-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.11 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(bromomethyl)-3,3-diethoxypropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(bromomethyl)-3,3-diethoxypropanal?
The IUPAC name of 2-(bromomethyl)-3,3-diethoxypropanal (CID 70700528) is 2-(bromomethyl)-3,3-diethoxypropanal.
What is the SMILES notation for 2-(bromomethyl)-3,3-diethoxypropanal?
The canonical SMILES for 2-(bromomethyl)-3,3-diethoxypropanal is CCOC(OCC)C(C=O)CBr.
What is the InChIKey of 2-(bromomethyl)-3,3-diethoxypropanal?
The InChIKey is SKCXVXRCRRNZPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15BrO3/c1-3-11-8(12-4-2)7(5-9)6-10/h6-8H,3-5H2,1-2H3.
What are the key properties of 2-(bromomethyl)-3,3-diethoxypropanal?
2-(bromomethyl)-3,3-diethoxypropanal has a molecular weight of 239.11 g/mol, XLogP of 1.60, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(bromomethyl)-3,3-diethoxypropanal is sourced from PubChem (CID 70700528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).