About 2-bromo-5-fluoro-3,6-dimethylterephthalic acid
2-bromo-5-fluoro-3,6-dimethylterephthalic acid (PubChem CID 70700596) has the molecular formula C10H8BrFO4
and a molecular weight of 291.07 g/mol. Its IUPAC name is 2-bromo-5-fluoro-3,6-dimethylterephthalic acid.
Molecular Properties
| Compound Name | 2-bromo-5-fluoro-3,6-dimethylterephthalic acid |
| PubChem CID | 70700596 |
| Molecular Formula | C10H8BrFO4 |
| Molecular Weight | 291.07 g/mol |
| Exact Mass | 289.96 |
| IUPAC Name | 2-bromo-5-fluoro-3,6-dimethylterephthalic acid |
| SMILES | Cc1c(Br)c(C(=O)O)c(C)c(F)c1C(=O)O |
| InChI | InChI=1S/C10H8BrFO4/c1-3-6(10(15)16)8(12)4(2)5(7(3)11)9(13)14/h1-2H3,(H,13,14)(H,15,16) |
| InChIKey | XFCOWGKHOZPULW-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.07 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-bromo-5-fluoro-3,6-dimethylterephthalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5-fluoro-3,6-dimethylterephthalic acid?
The IUPAC name of 2-bromo-5-fluoro-3,6-dimethylterephthalic acid (CID 70700596) is 2-bromo-5-fluoro-3,6-dimethylterephthalic acid.
What is the SMILES notation for 2-bromo-5-fluoro-3,6-dimethylterephthalic acid?
The canonical SMILES for 2-bromo-5-fluoro-3,6-dimethylterephthalic acid is Cc1c(Br)c(C(=O)O)c(C)c(F)c1C(=O)O.
What is the InChIKey of 2-bromo-5-fluoro-3,6-dimethylterephthalic acid?
The InChIKey is XFCOWGKHOZPULW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8BrFO4/c1-3-6(10(15)16)8(12)4(2)5(7(3)11)9(13)14/h1-2H3,(H,13,14)(H,15,16).
What are the key properties of 2-bromo-5-fluoro-3,6-dimethylterephthalic acid?
2-bromo-5-fluoro-3,6-dimethylterephthalic acid has a molecular weight of 291.07 g/mol, XLogP of 2.60, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5-fluoro-3,6-dimethylterephthalic acid is sourced from PubChem (CID 70700596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).