About (2R)-2-amino-2-(3,5-difluoro-2-pyridinyl)ethanol
(2R)-2-amino-2-(3,5-difluoro-2-pyridinyl)ethanol (PubChem CID 70700762) has the molecular formula C7H8F2N2O
and a molecular weight of 174.15 g/mol. Its IUPAC name is (2R)-2-amino-2-(3,5-difluoro-2-pyridinyl)ethanol.
Molecular Properties
| Compound Name | (2R)-2-amino-2-(3,5-difluoro-2-pyridinyl)ethanol |
| PubChem CID | 70700762 |
| Molecular Formula | C7H8F2N2O |
| Molecular Weight | 174.15 g/mol |
| Exact Mass | 174.06 |
| IUPAC Name | (2R)-2-amino-2-(3,5-difluoro-2-pyridinyl)ethanol |
| SMILES | N[C@@H](CO)c1ncc(F)cc1F |
| InChI | InChI=1S/C7H8F2N2O/c8-4-1-5(9)7(11-2-4)6(10)3-12/h1-2,6,12H,3,10H2/t6-/m0/s1 |
| InChIKey | AMGQRACZJQQGIM-LURJTMIESA-N |
| XLogP | 0.35 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.15 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-2-amino-2-(3,5-difluoro-2-pyridinyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-amino-2-(3,5-difluoro-2-pyridinyl)ethanol?
The IUPAC name of (2R)-2-amino-2-(3,5-difluoro-2-pyridinyl)ethanol (CID 70700762) is (2R)-2-amino-2-(3,5-difluoro-2-pyridinyl)ethanol.
What is the SMILES notation for (2R)-2-amino-2-(3,5-difluoro-2-pyridinyl)ethanol?
The canonical SMILES for (2R)-2-amino-2-(3,5-difluoro-2-pyridinyl)ethanol is N[C@@H](CO)c1ncc(F)cc1F.
What is the InChIKey of (2R)-2-amino-2-(3,5-difluoro-2-pyridinyl)ethanol?
The InChIKey is AMGQRACZJQQGIM-LURJTMIESA-N. The full InChI is InChI=1S/C7H8F2N2O/c8-4-1-5(9)7(11-2-4)6(10)3-12/h1-2,6,12H,3,10H2/t6-/m0/s1.
What are the key properties of (2R)-2-amino-2-(3,5-difluoro-2-pyridinyl)ethanol?
(2R)-2-amino-2-(3,5-difluoro-2-pyridinyl)ethanol has a molecular weight of 174.15 g/mol, XLogP of 0.35, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-2-(3,5-difluoro-2-pyridinyl)ethanol is sourced from PubChem (CID 70700762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).