C14H16N6 — CID 70700865
3,6-bis(2,4-dimethylpyrrol-1-yl)-1,2,4,5-tetrazine (PubChem CID 70700865) has the molecular formula C14H16N6 and a molecular weight of 268.32 g/mol. Its IUPAC name is 3,6-bis(2,4-dimethylpyrrol-1-yl)-1,2,4,5-tetrazine.
| Compound Name | 3,6-bis(2,4-dimethylpyrrol-1-yl)-1,2,4,5-tetrazine |
|---|---|
| PubChem CID | 70700865 |
| Molecular Formula | C14H16N6 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 3,6-bis(2,4-dimethylpyrrol-1-yl)-1,2,4,5-tetrazine |
| SMILES | Cc1cc(C)n(-c2nnc(-n3cc(C)cc3C)nn2)c1 |
| InChI | InChI=1S/C14H16N6/c1-9-5-11(3)19(7-9)13-15-17-14(18-16-13)20-8-10(2)6-12(20)4/h5-8H,1-4H3 |
| InChIKey | MCBFBEQRHJQQBF-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |