About (2-amino-1,3-dihydroinden-2-yl)phosphonic acid;hydrochloride
(2-amino-1,3-dihydroinden-2-yl)phosphonic acid;hydrochloride (PubChem CID 70700922) has the molecular formula C9H13ClNO3P
and a molecular weight of 249.63 g/mol. Its IUPAC name is (2-amino-1,3-dihydroinden-2-yl)phosphonic acid;hydrochloride.
Molecular Properties
| Compound Name | (2-amino-1,3-dihydroinden-2-yl)phosphonic acid;hydrochloride |
| PubChem CID | 70700922 |
| Molecular Formula | C9H13ClNO3P |
| Molecular Weight | 249.63 g/mol |
| Exact Mass | 249.03 |
| IUPAC Name | (2-amino-1,3-dihydroinden-2-yl)phosphonic acid;hydrochloride |
| SMILES | Cl.NC1(P(=O)(O)O)Cc2ccccc2C1 |
| InChI | InChI=1S/C9H12NO3P.ClH/c10-9(14(11,12)13)5-7-3-1-2-4-8(7)6-9;/h1-4H,5-6,10H2,(H2,11,12,13);1H |
| InChIKey | VZZDWKUDNIOOBD-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.63 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2-amino-1,3-dihydroinden-2-yl)phosphonic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-1,3-dihydroinden-2-yl)phosphonic acid;hydrochloride?
The IUPAC name of (2-amino-1,3-dihydroinden-2-yl)phosphonic acid;hydrochloride (CID 70700922) is (2-amino-1,3-dihydroinden-2-yl)phosphonic acid;hydrochloride.
What is the SMILES notation for (2-amino-1,3-dihydroinden-2-yl)phosphonic acid;hydrochloride?
The canonical SMILES for (2-amino-1,3-dihydroinden-2-yl)phosphonic acid;hydrochloride is Cl.NC1(P(=O)(O)O)Cc2ccccc2C1.
What is the InChIKey of (2-amino-1,3-dihydroinden-2-yl)phosphonic acid;hydrochloride?
The InChIKey is VZZDWKUDNIOOBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12NO3P.ClH/c10-9(14(11,12)13)5-7-3-1-2-4-8(7)6-9;/h1-4H,5-6,10H2,(H2,11,12,13);1H.
What are the key properties of (2-amino-1,3-dihydroinden-2-yl)phosphonic acid;hydrochloride?
(2-amino-1,3-dihydroinden-2-yl)phosphonic acid;hydrochloride has a molecular weight of 249.63 g/mol, XLogP of 1.04, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-1,3-dihydroinden-2-yl)phosphonic acid;hydrochloride is sourced from PubChem (CID 70700922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).