C22H18ClN3O3S — CID 70701405
CID 70701405 (PubChem CID 70701405) has the molecular formula C22H18ClN3O3S and a molecular weight of 439.92 g/mol.
| Compound Name | CID 70701405 |
|---|---|
| PubChem CID | 70701405 |
| Molecular Formula | C22H18ClN3O3S |
| Molecular Weight | 439.92 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | — |
| SMILES | O=[S+]([O-])(Nc1cnc2ccccc2c1)c1ccc(NCc2ccc(Cl)cc2O)cc1 |
| InChI | InChI=1S/C22H18ClN3O3S/c23-17-6-5-16(22(27)12-17)13-24-18-7-9-20(10-8-18)30(28,29)26-19-11-15-3-1-2-4-21(15)25-14-19/h1-12,14H,13H2,(H3-,24,26,27,28,29) |
| InChIKey | RXFLASGAQWZVFM-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.92 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|