C21H25N5O3 — CID 70701786
4-[2-(ethoxyamino)-5-methylpyrimidin-4-yl]-N-[(1S)-2-hydroxy-1-(3-methylphenyl)ethyl]-1H-pyrrole-2-carboxamide (PubChem CID 70701786) has the molecular formula C21H25N5O3 and a molecular weight of 395.46 g/mol. Its IUPAC name is 4-[2-(ethoxyamino)-5-methylpyrimidin-4-yl]-N-[(1S)-2-hydroxy-1-(3-methylphenyl)ethyl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-[2-(ethoxyamino)-5-methylpyrimidin-4-yl]-N-[(1S)-2-hydroxy-1-(3-methylphenyl)ethyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 70701786 |
| Molecular Formula | C21H25N5O3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 4-[2-(ethoxyamino)-5-methylpyrimidin-4-yl]-N-[(1S)-2-hydroxy-1-(3-methylphenyl)ethyl]-1H-pyrrole-2-carboxamide |
| SMILES | CCONc1ncc(C)c(-c2c[nH]c(C(=O)N[C@H](CO)c3cccc(C)c3)c2)n1 |
| InChI | InChI=1S/C21H25N5O3/c1-4-29-26-21-23-10-14(3)19(25-21)16-9-17(22-11-16)20(28)24-18(12-27)15-7-5-6-13(2)8-15/h5-11,18,22,27H,4,12H2,1-3H3,(H,24,28)(H,23,25,26)/t18-/m1/s1 |
| InChIKey | IDAFQOYRMFWOSD-GOSISDBHSA-N |
| XLogP | 2.92 |
| TPSA | 112.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|