C28H33BrO4 — CID 70701941
[(10R,13S,17R)-17-acetyl-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] 4-bromobenzoate (PubChem CID 70701941) has the molecular formula C28H33BrO4 and a molecular weight of 513.47 g/mol. Its IUPAC name is [(10R,13S,17R)-17-acetyl-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] 4-bromobenzoate.
| Compound Name | [(10R,13S,17R)-17-acetyl-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] 4-bromobenzoate |
|---|---|
| PubChem CID | 70701941 |
| Molecular Formula | C28H33BrO4 |
| Molecular Weight | 513.47 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | [(10R,13S,17R)-17-acetyl-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] 4-bromobenzoate |
| SMILES | CC(=O)[C@@]1(OC(=O)c2ccc(Br)cc2)CCC2C3CCC4=CC(=O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C28H33BrO4/c1-17(30)28(33-25(32)18-4-7-20(29)8-5-18)15-12-24-22-9-6-19-16-21(31)10-13-26(19,2)23(22)11-14-27(24,28)3/h4-5,7-8,16,22-24H,6,9-15H2,1-3H3/t22?,23?,24?,26-,27-,28-/m0/s1 |
| InChIKey | MCLPHRIHXTXHGM-SVKPFUFZSA-N |
| XLogP | 6.47 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.47 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |