C13H15N3O4 — CID 70701967
(2R,4R,5R)-5-[(4-phenyltriazol-1-yl)methyl]oxolane-2,3,4-triol (PubChem CID 70701967) has the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. Its IUPAC name is (2R,4R,5R)-5-[(4-phenyltriazol-1-yl)methyl]oxolane-2,3,4-triol.
| Compound Name | (2R,4R,5R)-5-[(4-phenyltriazol-1-yl)methyl]oxolane-2,3,4-triol |
|---|---|
| PubChem CID | 70701967 |
| Molecular Formula | C13H15N3O4 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | (2R,4R,5R)-5-[(4-phenyltriazol-1-yl)methyl]oxolane-2,3,4-triol |
| SMILES | OC1[C@H](O)O[C@H](Cn2cc(-c3ccccc3)nn2)[C@@H]1O |
| InChI | InChI=1S/C13H15N3O4/c17-11-10(20-13(19)12(11)18)7-16-6-9(14-15-16)8-4-2-1-3-5-8/h1-6,10-13,17-19H,7H2/t10-,11+,12?,13-/m1/s1 |
| InChIKey | AJZFQKOAUIHNQF-ZGVCCVRISA-N |
| XLogP | -0.62 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |