C21H16ClF3N5O3- — CID 70701995
2-[[4-[[5-chloro-6-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]amino]pyrrolo[3,2-d]pyrimidin-5-yl]methoxy]ethanolate (PubChem CID 70701995) has the molecular formula C21H16ClF3N5O3- and a molecular weight of 478.84 g/mol. Its IUPAC name is 2-[[4-[[5-chloro-6-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]amino]pyrrolo[3,2-d]pyrimidin-5-yl]methoxy]ethanolate.
| Compound Name | 2-[[4-[[5-chloro-6-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]amino]pyrrolo[3,2-d]pyrimidin-5-yl]methoxy]ethanolate |
|---|---|
| PubChem CID | 70701995 |
| Molecular Formula | C21H16ClF3N5O3- |
| Molecular Weight | 478.84 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | 2-[[4-[[5-chloro-6-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]amino]pyrrolo[3,2-d]pyrimidin-5-yl]methoxy]ethanolate |
| SMILES | [O-]CCOCn1ccc2ncnc(Nc3cnc(Oc4cccc(C(F)(F)F)c4)c(Cl)c3)c21 |
| InChI | InChI=1S/C21H16ClF3N5O3/c22-16-9-14(10-26-20(16)33-15-3-1-2-13(8-15)21(23,24)25)29-19-18-17(27-11-28-19)4-5-30(18)12-32-7-6-31/h1-5,8-11H,6-7,12H2,(H,27,28,29)/q-1 |
| InChIKey | SBMNMLFWVOAHCS-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 97.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.84 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|