About [2-(6-methoxy-2,2,4-trimethylquinolin-1-yl)-2-oxoethyl]-(thiophen-2-ylmethyl)azanium
[2-(6-methoxy-2,2,4-trimethylquinolin-1-yl)-2-oxoethyl]-(thiophen-2-ylmethyl)azanium (PubChem CID 7070264) has the molecular formula C20H25N2O2S+
and a molecular weight of 357.50 g/mol. Its IUPAC name is [2-(6-methoxy-2,2,4-trimethylquinolin-1-yl)-2-oxoethyl]-(thiophen-2-ylmethyl)azanium.
Molecular Properties
| Compound Name | [2-(6-methoxy-2,2,4-trimethylquinolin-1-yl)-2-oxoethyl]-(thiophen-2-ylmethyl)azanium |
| PubChem CID | 7070264 |
| Molecular Formula | C20H25N2O2S+ |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | [2-(6-methoxy-2,2,4-trimethylquinolin-1-yl)-2-oxoethyl]-(thiophen-2-ylmethyl)azanium |
| SMILES | COc1ccc2c(c1)C(C)=CC(C)(C)N2C(=O)C[NH2+]Cc1cccs1 |
| InChI | InChI=1S/C20H24N2O2S/c1-14-11-20(2,3)22(18-8-7-15(24-4)10-17(14)18)19(23)13-21-12-16-6-5-9-25-16/h5-11,21H,12-13H2,1-4H3/p+1 |
| InChIKey | XPZMBSRQAXXOCN-UHFFFAOYSA-O |
| XLogP | 3.05 |
| TPSA | 46.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(6-methoxy-2,2,4-trimethylquinolin-1-yl)-2-oxoethyl]-(thiophen-2-ylmethyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(6-methoxy-2,2,4-trimethylquinolin-1-yl)-2-oxoethyl]-(thiophen-2-ylmethyl)azanium?
The IUPAC name of [2-(6-methoxy-2,2,4-trimethylquinolin-1-yl)-2-oxoethyl]-(thiophen-2-ylmethyl)azanium (CID 7070264) is [2-(6-methoxy-2,2,4-trimethylquinolin-1-yl)-2-oxoethyl]-(thiophen-2-ylmethyl)azanium.
What is the SMILES notation for [2-(6-methoxy-2,2,4-trimethylquinolin-1-yl)-2-oxoethyl]-(thiophen-2-ylmethyl)azanium?
The canonical SMILES for [2-(6-methoxy-2,2,4-trimethylquinolin-1-yl)-2-oxoethyl]-(thiophen-2-ylmethyl)azanium is COc1ccc2c(c1)C(C)=CC(C)(C)N2C(=O)C[NH2+]Cc1cccs1.
What is the InChIKey of [2-(6-methoxy-2,2,4-trimethylquinolin-1-yl)-2-oxoethyl]-(thiophen-2-ylmethyl)azanium?
The InChIKey is XPZMBSRQAXXOCN-UHFFFAOYSA-O. The full InChI is InChI=1S/C20H24N2O2S/c1-14-11-20(2,3)22(18-8-7-15(24-4)10-17(14)18)19(23)13-21-12-16-6-5-9-25-16/h5-11,21H,12-13H2,1-4H3/p+1.
What are the key properties of [2-(6-methoxy-2,2,4-trimethylquinolin-1-yl)-2-oxoethyl]-(thiophen-2-ylmethyl)azanium?
[2-(6-methoxy-2,2,4-trimethylquinolin-1-yl)-2-oxoethyl]-(thiophen-2-ylmethyl)azanium has a molecular weight of 357.50 g/mol, XLogP of 3.05, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(6-methoxy-2,2,4-trimethylquinolin-1-yl)-2-oxoethyl]-(thiophen-2-ylmethyl)azanium is sourced from PubChem (CID 7070264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).