C19H26N6O — CID 70702726
4-[2-(ethylamino)-6-methylpyrimidin-4-yl]-N-(3-methylphenyl)piperazine-1-carboxamide (PubChem CID 70702726) has the molecular formula C19H26N6O and a molecular weight of 354.46 g/mol. Its IUPAC name is 4-[2-(ethylamino)-6-methylpyrimidin-4-yl]-N-(3-methylphenyl)piperazine-1-carboxamide.
| Compound Name | 4-[2-(ethylamino)-6-methylpyrimidin-4-yl]-N-(3-methylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 70702726 |
| Molecular Formula | C19H26N6O |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 4-[2-(ethylamino)-6-methylpyrimidin-4-yl]-N-(3-methylphenyl)piperazine-1-carboxamide |
| SMILES | CCNc1nc(C)cc(N2CCN(C(=O)Nc3cccc(C)c3)CC2)n1 |
| InChI | InChI=1S/C19H26N6O/c1-4-20-18-21-15(3)13-17(23-18)24-8-10-25(11-9-24)19(26)22-16-7-5-6-14(2)12-16/h5-7,12-13H,4,8-11H2,1-3H3,(H,22,26)(H,20,21,23) |
| InChIKey | PKBGOOIVDYRSEJ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |