C13H13ClN2O — CID 707032
(1R)-6-chloro-2,3,4,9-tetrahydro-1H-carbazole-1-carboxamide (PubChem CID 707032) has the molecular formula C13H13ClN2O and a molecular weight of 248.71 g/mol. Its IUPAC name is (1R)-6-chloro-2,3,4,9-tetrahydro-1H-carbazole-1-carboxamide.
| Compound Name | (1R)-6-chloro-2,3,4,9-tetrahydro-1H-carbazole-1-carboxamide |
|---|---|
| PubChem CID | 707032 |
| Molecular Formula | C13H13ClN2O |
| Molecular Weight | 248.71 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | (1R)-6-chloro-2,3,4,9-tetrahydro-1H-carbazole-1-carboxamide |
| SMILES | NC(=O)[C@@H]1CCCc2c1[nH]c1ccc(Cl)cc21 |
| InChI | InChI=1S/C13H13ClN2O/c14-7-4-5-11-10(6-7)8-2-1-3-9(13(15)17)12(8)16-11/h4-6,9,16H,1-3H2,(H2,15,17)/t9-/m1/s1 |
| InChIKey | FUZYTVDVLBBXDL-SECBINFHSA-N |
| XLogP | 2.73 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.71 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |