C20H20F3NO4 — CID 7070388
(3R,4Z)-3-(3,4-dimethoxyphenyl)-4-[[3-(trifluoromethyl)phenyl]methoxyimino]butan-2-one (PubChem CID 7070388) has the molecular formula C20H20F3NO4 and a molecular weight of 395.38 g/mol. Its IUPAC name is (3R,4Z)-3-(3,4-dimethoxyphenyl)-4-[[3-(trifluoromethyl)phenyl]methoxyimino]butan-2-one.
| Compound Name | (3R,4Z)-3-(3,4-dimethoxyphenyl)-4-[[3-(trifluoromethyl)phenyl]methoxyimino]butan-2-one |
|---|---|
| PubChem CID | 7070388 |
| Molecular Formula | C20H20F3NO4 |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | (3R,4Z)-3-(3,4-dimethoxyphenyl)-4-[[3-(trifluoromethyl)phenyl]methoxyimino]butan-2-one |
| SMILES | COc1ccc([C@H](/C=N\OCc2cccc(C(F)(F)F)c2)C(C)=O)cc1OC |
| InChI | InChI=1S/C20H20F3NO4/c1-13(25)17(15-7-8-18(26-2)19(10-15)27-3)11-24-28-12-14-5-4-6-16(9-14)20(21,22)23/h4-11,17H,12H2,1-3H3/b24-11-/t17-/m1/s1 |
| InChIKey | FOZAKHHZHTWEJX-BYRCZEICSA-N |
| XLogP | 4.60 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|