C16H12F3N3 — CID 70704050
N-(2-methylphenyl)-2-(trifluoromethyl)quinazolin-4-amine (PubChem CID 70704050) has the molecular formula C16H12F3N3 and a molecular weight of 303.29 g/mol. Its IUPAC name is N-(2-methylphenyl)-2-(trifluoromethyl)quinazolin-4-amine.
| Compound Name | N-(2-methylphenyl)-2-(trifluoromethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 70704050 |
| Molecular Formula | C16H12F3N3 |
| Molecular Weight | 303.29 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | N-(2-methylphenyl)-2-(trifluoromethyl)quinazolin-4-amine |
| SMILES | Cc1ccccc1Nc1nc(C(F)(F)F)nc2ccccc12 |
| InChI | InChI=1S/C16H12F3N3/c1-10-6-2-4-8-12(10)20-14-11-7-3-5-9-13(11)21-15(22-14)16(17,18)19/h2-9H,1H3,(H,20,21,22) |
| InChIKey | GBUAWPFGYLKKFK-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.29 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |