C16H22N6O2S — CID 70704262
2-[[(3-aminothiophene-2-carbonyl)amino]methyl]-N,N-dimethyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carboxamide (PubChem CID 70704262) has the molecular formula C16H22N6O2S and a molecular weight of 362.46 g/mol. Its IUPAC name is 2-[[(3-aminothiophene-2-carbonyl)amino]methyl]-N,N-dimethyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carboxamide.
| Compound Name | 2-[[(3-aminothiophene-2-carbonyl)amino]methyl]-N,N-dimethyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carboxamide |
|---|---|
| PubChem CID | 70704262 |
| Molecular Formula | C16H22N6O2S |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 2-[[(3-aminothiophene-2-carbonyl)amino]methyl]-N,N-dimethyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carboxamide |
| SMILES | CN(C)C(=O)N1CCCn2nc(CNC(=O)c3sccc3N)cc2C1 |
| InChI | InChI=1S/C16H22N6O2S/c1-20(2)16(24)21-5-3-6-22-12(10-21)8-11(19-22)9-18-15(23)14-13(17)4-7-25-14/h4,7-8H,3,5-6,9-10,17H2,1-2H3,(H,18,23) |
| InChIKey | IIYVLLHNZUKQGO-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |