About 4-[[2-[1-(2-methyl-4-pyridinyl)piperidin-4-yl]imidazol-1-yl]methyl]-1,3-thiazole
4-[[2-[1-(2-methyl-4-pyridinyl)piperidin-4-yl]imidazol-1-yl]methyl]-1,3-thiazole (PubChem CID 70704927) has the molecular formula C18H21N5S
and a molecular weight of 339.47 g/mol. Its IUPAC name is 4-[[2-[1-(2-methyl-4-pyridinyl)piperidin-4-yl]imidazol-1-yl]methyl]-1,3-thiazole.
Molecular Properties
| Compound Name | 4-[[2-[1-(2-methyl-4-pyridinyl)piperidin-4-yl]imidazol-1-yl]methyl]-1,3-thiazole |
| PubChem CID | 70704927 |
| Molecular Formula | C18H21N5S |
| Molecular Weight | 339.47 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 4-[[2-[1-(2-methyl-4-pyridinyl)piperidin-4-yl]imidazol-1-yl]methyl]-1,3-thiazole |
| SMILES | Cc1cc(N2CCC(c3nccn3Cc3cscn3)CC2)ccn1 |
| InChI | InChI=1S/C18H21N5S/c1-14-10-17(2-5-19-14)22-7-3-15(4-8-22)18-20-6-9-23(18)11-16-12-24-13-21-16/h2,5-6,9-10,12-13,15H,3-4,7-8,11H2,1H3 |
| InChIKey | HXUVDJYAVDJVPM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[[2-[1-(2-methyl-4-pyridinyl)piperidin-4-yl]imidazol-1-yl]methyl]-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[2-[1-(2-methyl-4-pyridinyl)piperidin-4-yl]imidazol-1-yl]methyl]-1,3-thiazole?
The IUPAC name of 4-[[2-[1-(2-methyl-4-pyridinyl)piperidin-4-yl]imidazol-1-yl]methyl]-1,3-thiazole (CID 70704927) is 4-[[2-[1-(2-methyl-4-pyridinyl)piperidin-4-yl]imidazol-1-yl]methyl]-1,3-thiazole.
What is the SMILES notation for 4-[[2-[1-(2-methyl-4-pyridinyl)piperidin-4-yl]imidazol-1-yl]methyl]-1,3-thiazole?
The canonical SMILES for 4-[[2-[1-(2-methyl-4-pyridinyl)piperidin-4-yl]imidazol-1-yl]methyl]-1,3-thiazole is Cc1cc(N2CCC(c3nccn3Cc3cscn3)CC2)ccn1.
What is the InChIKey of 4-[[2-[1-(2-methyl-4-pyridinyl)piperidin-4-yl]imidazol-1-yl]methyl]-1,3-thiazole?
The InChIKey is HXUVDJYAVDJVPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N5S/c1-14-10-17(2-5-19-14)22-7-3-15(4-8-22)18-20-6-9-23(18)11-16-12-24-13-21-16/h2,5-6,9-10,12-13,15H,3-4,7-8,11H2,1H3.
What are the key properties of 4-[[2-[1-(2-methyl-4-pyridinyl)piperidin-4-yl]imidazol-1-yl]methyl]-1,3-thiazole?
4-[[2-[1-(2-methyl-4-pyridinyl)piperidin-4-yl]imidazol-1-yl]methyl]-1,3-thiazole has a molecular weight of 339.47 g/mol, XLogP of 3.48, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2-[1-(2-methyl-4-pyridinyl)piperidin-4-yl]imidazol-1-yl]methyl]-1,3-thiazole is sourced from PubChem (CID 70704927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).