C14H22N6O3S — CID 70704976
1-[(4aR,7aS)-1-(cyclopropylmethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-3-(tetrazol-1-yl)propan-1-one (PubChem CID 70704976) has the molecular formula C14H22N6O3S and a molecular weight of 354.44 g/mol. Its IUPAC name is 1-[(4aR,7aS)-1-(cyclopropylmethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-3-(tetrazol-1-yl)propan-1-one.
| Compound Name | 1-[(4aR,7aS)-1-(cyclopropylmethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-3-(tetrazol-1-yl)propan-1-one |
|---|---|
| PubChem CID | 70704976 |
| Molecular Formula | C14H22N6O3S |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 1-[(4aR,7aS)-1-(cyclopropylmethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-3-(tetrazol-1-yl)propan-1-one |
| SMILES | O=C(CCn1cnnn1)N1CCN(CC2CC2)[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C14H22N6O3S/c21-14(3-4-19-10-15-16-17-19)20-6-5-18(7-11-1-2-11)12-8-24(22,23)9-13(12)20/h10-13H,1-9H2/t12-,13+/m1/s1 |
| InChIKey | XAGPHROZGFZPSE-OLZOCXBDSA-N |
| XLogP | -1.22 |
| TPSA | 101.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |