C17H21ClN4O2S — CID 70704984
(4aR,7aS)-4-[[1-(2-chlorophenyl)pyrazol-4-yl]methyl]-1-methyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide (PubChem CID 70704984) has the molecular formula C17H21ClN4O2S and a molecular weight of 380.90 g/mol. Its IUPAC name is (4aR,7aS)-4-[[1-(2-chlorophenyl)pyrazol-4-yl]methyl]-1-methyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide.
| Compound Name | (4aR,7aS)-4-[[1-(2-chlorophenyl)pyrazol-4-yl]methyl]-1-methyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
|---|---|
| PubChem CID | 70704984 |
| Molecular Formula | C17H21ClN4O2S |
| Molecular Weight | 380.90 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | (4aR,7aS)-4-[[1-(2-chlorophenyl)pyrazol-4-yl]methyl]-1-methyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
| SMILES | CN1CCN(Cc2cnn(-c3ccccc3Cl)c2)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C17H21ClN4O2S/c1-20-6-7-21(17-12-25(23,24)11-16(17)20)9-13-8-19-22(10-13)15-5-3-2-4-14(15)18/h2-5,8,10,16-17H,6-7,9,11-12H2,1H3/t16-,17+/m1/s1 |
| InChIKey | RFWWLZVJZWKDMA-SJORKVTESA-N |
| XLogP | 1.44 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.90 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |