C24H29N3O4 — CID 70704992
(1R,7S)-6-[(3aS,6aR)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-3-[(3-methoxyphenyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-en-4-one (PubChem CID 70704992) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is (1R,7S)-6-[(3aS,6aR)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-3-[(3-methoxyphenyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-en-4-one.
| Compound Name | (1R,7S)-6-[(3aS,6aR)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-3-[(3-methoxyphenyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-en-4-one |
|---|---|
| PubChem CID | 70704992 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | (1R,7S)-6-[(3aS,6aR)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-3-[(3-methoxyphenyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-en-4-one |
| SMILES | COc1cccc(CN2C[C@]34C=C[C@H](O3)C(C(=O)N3C[C@H]5CN(C)C[C@H]5C3)C4C2=O)c1 |
| InChI | InChI=1S/C24H29N3O4/c1-25-10-16-12-26(13-17(16)11-25)22(28)20-19-6-7-24(31-19)14-27(23(29)21(20)24)9-15-4-3-5-18(8-15)30-2/h3-8,16-17,19-21H,9-14H2,1-2H3/t16-,17+,19-,20?,21?,24-/m0/s1 |
| InChIKey | RTEDVGFVKIWDPH-FHUIUCCXSA-N |
| XLogP | 1.00 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|