C23H25N3O — CID 70705116
2-[(3aS,6aS)-1-(3-phenylpropyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carbonyl]benzonitrile (PubChem CID 70705116) has the molecular formula C23H25N3O and a molecular weight of 359.47 g/mol. Its IUPAC name is 2-[(3aS,6aS)-1-(3-phenylpropyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carbonyl]benzonitrile.
| Compound Name | 2-[(3aS,6aS)-1-(3-phenylpropyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carbonyl]benzonitrile |
|---|---|
| PubChem CID | 70705116 |
| Molecular Formula | C23H25N3O |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 2-[(3aS,6aS)-1-(3-phenylpropyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carbonyl]benzonitrile |
| SMILES | N#Cc1ccccc1C(=O)N1C[C@@H]2CCN(CCCc3ccccc3)[C@@H]2C1 |
| InChI | InChI=1S/C23H25N3O/c24-15-19-10-4-5-11-21(19)23(27)26-16-20-12-14-25(22(20)17-26)13-6-9-18-7-2-1-3-8-18/h1-5,7-8,10-11,20,22H,6,9,12-14,16-17H2/t20-,22+/m0/s1 |
| InChIKey | KGSSTJHHSVTNDV-RBBKRZOGSA-N |
| XLogP | 3.34 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |