C15H21N5O3 — CID 70705641
N-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]methyl]-5,6-dimethyl-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 70705641) has the molecular formula C15H21N5O3 and a molecular weight of 319.37 g/mol. Its IUPAC name is N-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]methyl]-5,6-dimethyl-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]methyl]-5,6-dimethyl-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 70705641 |
| Molecular Formula | C15H21N5O3 |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | N-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]methyl]-5,6-dimethyl-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | COCCCn1cnnc1CNC(=O)c1cc(C)c(C)[nH]c1=O |
| InChI | InChI=1S/C15H21N5O3/c1-10-7-12(15(22)18-11(10)2)14(21)16-8-13-19-17-9-20(13)5-4-6-23-3/h7,9H,4-6,8H2,1-3H3,(H,16,21)(H,18,22) |
| InChIKey | KRYGWEPCVZDXSO-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|