C15H20N2O6S — CID 70705671
1-[(4aR,7aS)-4-(5-methoxyfuran-2-carbonyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]propan-1-one (PubChem CID 70705671) has the molecular formula C15H20N2O6S and a molecular weight of 356.40 g/mol. Its IUPAC name is 1-[(4aR,7aS)-4-(5-methoxyfuran-2-carbonyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]propan-1-one.
| Compound Name | 1-[(4aR,7aS)-4-(5-methoxyfuran-2-carbonyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 70705671 |
| Molecular Formula | C15H20N2O6S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 1-[(4aR,7aS)-4-(5-methoxyfuran-2-carbonyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]propan-1-one |
| SMILES | CCC(=O)N1CCN(C(=O)c2ccc(OC)o2)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C15H20N2O6S/c1-3-13(18)16-6-7-17(11-9-24(20,21)8-10(11)16)15(19)12-4-5-14(22-2)23-12/h4-5,10-11H,3,6-9H2,1-2H3/t10-,11+/m1/s1 |
| InChIKey | ARKDENJKUDHAJK-MNOVXSKESA-N |
| XLogP | 0.15 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |