C15H24N6O2S — CID 70705703
(4aS,7aR)-4-[2-(1,4-diazepan-1-yl)pyrimidin-4-yl]-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazine 6,6-dioxide (PubChem CID 70705703) has the molecular formula C15H24N6O2S and a molecular weight of 352.46 g/mol. Its IUPAC name is (4aS,7aR)-4-[2-(1,4-diazepan-1-yl)pyrimidin-4-yl]-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazine 6,6-dioxide.
| Compound Name | (4aS,7aR)-4-[2-(1,4-diazepan-1-yl)pyrimidin-4-yl]-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazine 6,6-dioxide |
|---|---|
| PubChem CID | 70705703 |
| Molecular Formula | C15H24N6O2S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | (4aS,7aR)-4-[2-(1,4-diazepan-1-yl)pyrimidin-4-yl]-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazine 6,6-dioxide |
| SMILES | O=S1(=O)C[C@@H]2NCCN(c3ccnc(N4CCCNCC4)n3)[C@@H]2C1 |
| InChI | InChI=1S/C15H24N6O2S/c22-24(23)10-12-13(11-24)21(9-6-17-12)14-2-4-18-15(19-14)20-7-1-3-16-5-8-20/h2,4,12-13,16-17H,1,3,5-11H2/t12-,13+/m0/s1 |
| InChIKey | PITPHOYJTIJUHM-QWHCGFSZSA-N |
| XLogP | -1.15 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |