C18H25N3OS — CID 70705789
1-[1-(6-methyl-1,3-benzothiazol-2-yl)piperidin-4-yl]piperidin-3-ol (PubChem CID 70705789) has the molecular formula C18H25N3OS and a molecular weight of 331.49 g/mol. Its IUPAC name is 1-[1-(6-methyl-1,3-benzothiazol-2-yl)piperidin-4-yl]piperidin-3-ol.
| Compound Name | 1-[1-(6-methyl-1,3-benzothiazol-2-yl)piperidin-4-yl]piperidin-3-ol |
|---|---|
| PubChem CID | 70705789 |
| Molecular Formula | C18H25N3OS |
| Molecular Weight | 331.49 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 1-[1-(6-methyl-1,3-benzothiazol-2-yl)piperidin-4-yl]piperidin-3-ol |
| SMILES | Cc1ccc2nc(N3CCC(N4CCCC(O)C4)CC3)sc2c1 |
| InChI | InChI=1S/C18H25N3OS/c1-13-4-5-16-17(11-13)23-18(19-16)20-9-6-14(7-10-20)21-8-2-3-15(22)12-21/h4-5,11,14-15,22H,2-3,6-10,12H2,1H3 |
| InChIKey | ZBWYQGVZNNJFKL-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.49 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |