C12H24N2O3S — CID 70706507
(4aR,7aS)-4-(2-ethoxyethyl)-1-ethyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide (PubChem CID 70706507) has the molecular formula C12H24N2O3S and a molecular weight of 276.40 g/mol. Its IUPAC name is (4aR,7aS)-4-(2-ethoxyethyl)-1-ethyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide.
| Compound Name | (4aR,7aS)-4-(2-ethoxyethyl)-1-ethyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
|---|---|
| PubChem CID | 70706507 |
| Molecular Formula | C12H24N2O3S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | (4aR,7aS)-4-(2-ethoxyethyl)-1-ethyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
| SMILES | CCOCCN1CCN(CC)[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C12H24N2O3S/c1-3-13-5-6-14(7-8-17-4-2)12-10-18(15,16)9-11(12)13/h11-12H,3-10H2,1-2H3/t11-,12+/m1/s1 |
| InChIKey | GBEGKMPFARDVKP-NEPJUHHUSA-N |
| XLogP | -0.17 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|