C18H26N4O3S — CID 70706982
(4aR,7aS)-4-[(1-ethylimidazol-2-yl)methyl]-1-[(5-methylfuran-2-yl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide (PubChem CID 70706982) has the molecular formula C18H26N4O3S and a molecular weight of 378.50 g/mol. Its IUPAC name is (4aR,7aS)-4-[(1-ethylimidazol-2-yl)methyl]-1-[(5-methylfuran-2-yl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide.
| Compound Name | (4aR,7aS)-4-[(1-ethylimidazol-2-yl)methyl]-1-[(5-methylfuran-2-yl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
|---|---|
| PubChem CID | 70706982 |
| Molecular Formula | C18H26N4O3S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | (4aR,7aS)-4-[(1-ethylimidazol-2-yl)methyl]-1-[(5-methylfuran-2-yl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
| SMILES | CCn1ccnc1CN1CCN(Cc2ccc(C)o2)[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C18H26N4O3S/c1-3-20-7-6-19-18(20)11-22-9-8-21(10-15-5-4-14(2)25-15)16-12-26(23,24)13-17(16)22/h4-7,16-17H,3,8-13H2,1-2H3/t16-,17+/m1/s1 |
| InChIKey | HAVGLZDLHCQWSV-SJORKVTESA-N |
| XLogP | 1.29 |
| TPSA | 71.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |