C14H17F3N4O3S — CID 70707150
1-[(4aR,7aS)-6,6-dioxo-1-pyrimidin-2-yl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-4,4,4-trifluorobutan-1-one (PubChem CID 70707150) has the molecular formula C14H17F3N4O3S and a molecular weight of 378.38 g/mol. Its IUPAC name is 1-[(4aR,7aS)-6,6-dioxo-1-pyrimidin-2-yl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-4,4,4-trifluorobutan-1-one.
| Compound Name | 1-[(4aR,7aS)-6,6-dioxo-1-pyrimidin-2-yl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-4,4,4-trifluorobutan-1-one |
|---|---|
| PubChem CID | 70707150 |
| Molecular Formula | C14H17F3N4O3S |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 1-[(4aR,7aS)-6,6-dioxo-1-pyrimidin-2-yl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-4,4,4-trifluorobutan-1-one |
| SMILES | O=C(CCC(F)(F)F)N1CCN(c2ncccn2)[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C14H17F3N4O3S/c15-14(16,17)3-2-12(22)20-6-7-21(13-18-4-1-5-19-13)11-9-25(23,24)8-10(11)20/h1,4-5,10-11H,2-3,6-9H2/t10-,11+/m0/s1 |
| InChIKey | AXKNBGIDRVGKOY-WDEREUQCSA-N |
| XLogP | 0.63 |
| TPSA | 83.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |