C12H17N3O5S3 — CID 70707231
[(4aS,7aR)-4-methylsulfonyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-(2-methyl-1,3-thiazol-4-yl)methanone (PubChem CID 70707231) has the molecular formula C12H17N3O5S3 and a molecular weight of 379.49 g/mol. Its IUPAC name is [(4aS,7aR)-4-methylsulfonyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-(2-methyl-1,3-thiazol-4-yl)methanone.
| Compound Name | [(4aS,7aR)-4-methylsulfonyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-(2-methyl-1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 70707231 |
| Molecular Formula | C12H17N3O5S3 |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.03 |
| IUPAC Name | [(4aS,7aR)-4-methylsulfonyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-(2-methyl-1,3-thiazol-4-yl)methanone |
| SMILES | Cc1nc(C(=O)N2CCN(S(C)(=O)=O)[C@@H]3CS(=O)(=O)C[C@@H]32)cs1 |
| InChI | InChI=1S/C12H17N3O5S3/c1-8-13-9(5-21-8)12(16)14-3-4-15(22(2,17)18)11-7-23(19,20)6-10(11)14/h5,10-11H,3-4,6-7H2,1-2H3/t10-,11+/m0/s1 |
| InChIKey | GYLOUQZJQPIVMY-WDEREUQCSA-N |
| XLogP | -0.67 |
| TPSA | 104.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |