C22H29N3O3 — CID 70707350
(4aS,8aR)-1-[2-(cyclohexen-1-yl)ethyl]-6-(6-oxo-1H-pyridine-3-carbonyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 70707350) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is (4aS,8aR)-1-[2-(cyclohexen-1-yl)ethyl]-6-(6-oxo-1H-pyridine-3-carbonyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aR)-1-[2-(cyclohexen-1-yl)ethyl]-6-(6-oxo-1H-pyridine-3-carbonyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 70707350 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | (4aS,8aR)-1-[2-(cyclohexen-1-yl)ethyl]-6-(6-oxo-1H-pyridine-3-carbonyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | O=C(c1ccc(=O)[nH]c1)N1CC[C@@H]2[C@@H](CCC(=O)N2CCC2=CCCCC2)C1 |
| InChI | InChI=1S/C22H29N3O3/c26-20-8-6-17(14-23-20)22(28)24-12-11-19-18(15-24)7-9-21(27)25(19)13-10-16-4-2-1-3-5-16/h4,6,8,14,18-19H,1-3,5,7,9-13,15H2,(H,23,26)/t18-,19+/m0/s1 |
| InChIKey | FZQCBXHNHMFFRL-RBUKOAKNSA-N |
| XLogP | 2.72 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|