C18H25N3O3S — CID 70707520
[(4aR,7aS)-1-ethyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(1,2,3,4-tetrahydroquinolin-6-yl)methanone (PubChem CID 70707520) has the molecular formula C18H25N3O3S and a molecular weight of 363.48 g/mol. Its IUPAC name is [(4aR,7aS)-1-ethyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(1,2,3,4-tetrahydroquinolin-6-yl)methanone.
| Compound Name | [(4aR,7aS)-1-ethyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(1,2,3,4-tetrahydroquinolin-6-yl)methanone |
|---|---|
| PubChem CID | 70707520 |
| Molecular Formula | C18H25N3O3S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | [(4aR,7aS)-1-ethyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(1,2,3,4-tetrahydroquinolin-6-yl)methanone |
| SMILES | CCN1CCN(C(=O)c2ccc3c(c2)CCCN3)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C18H25N3O3S/c1-2-20-8-9-21(17-12-25(23,24)11-16(17)20)18(22)14-5-6-15-13(10-14)4-3-7-19-15/h5-6,10,16-17,19H,2-4,7-9,11-12H2,1H3/t16-,17+/m1/s1 |
| InChIKey | DAAYEVPJUPHOGO-SJORKVTESA-N |
| XLogP | 0.99 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |