C16H25N3O5S — CID 70707813
[(4aR,7aS)-1-(2-methoxyethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(5-propan-2-yl-1,2-oxazol-3-yl)methanone (PubChem CID 70707813) has the molecular formula C16H25N3O5S and a molecular weight of 371.46 g/mol. Its IUPAC name is [(4aR,7aS)-1-(2-methoxyethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(5-propan-2-yl-1,2-oxazol-3-yl)methanone.
| Compound Name | [(4aR,7aS)-1-(2-methoxyethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(5-propan-2-yl-1,2-oxazol-3-yl)methanone |
|---|---|
| PubChem CID | 70707813 |
| Molecular Formula | C16H25N3O5S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | [(4aR,7aS)-1-(2-methoxyethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(5-propan-2-yl-1,2-oxazol-3-yl)methanone |
| SMILES | COCCN1CCN(C(=O)c2cc(C(C)C)on2)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C16H25N3O5S/c1-11(2)15-8-12(17-24-15)16(20)19-5-4-18(6-7-23-3)13-9-25(21,22)10-14(13)19/h8,11,13-14H,4-7,9-10H2,1-3H3/t13-,14+/m1/s1 |
| InChIKey | WWLKWWSDVZEGBN-KGLIPLIRSA-N |
| XLogP | 0.37 |
| TPSA | 92.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |