C16H22N6O3S — CID 70707848
[(4aR,7aS)-1-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(7-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl)methanone (PubChem CID 70707848) has the molecular formula C16H22N6O3S and a molecular weight of 378.46 g/mol. Its IUPAC name is [(4aR,7aS)-1-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(7-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl)methanone.
| Compound Name | [(4aR,7aS)-1-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(7-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl)methanone |
|---|---|
| PubChem CID | 70707848 |
| Molecular Formula | C16H22N6O3S |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | [(4aR,7aS)-1-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(7-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl)methanone |
| SMILES | CC(C)c1cc(C(=O)N2CCN(C)[C@@H]3CS(=O)(=O)C[C@@H]32)nc2ncnn12 |
| InChI | InChI=1S/C16H22N6O3S/c1-10(2)12-6-11(19-16-17-9-18-22(12)16)15(23)21-5-4-20(3)13-7-26(24,25)8-14(13)21/h6,9-10,13-14H,4-5,7-8H2,1-3H3/t13-,14+/m1/s1 |
| InChIKey | KFSCLHOYOHIVQF-KGLIPLIRSA-N |
| XLogP | -0.20 |
| TPSA | 100.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |