C17H24N4O4S — CID 70707893
[(4aR,7aS)-6,6-dioxo-4-(2-propylpyrazole-3-carbonyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-cyclopropylmethanone (PubChem CID 70707893) has the molecular formula C17H24N4O4S and a molecular weight of 380.47 g/mol. Its IUPAC name is [(4aR,7aS)-6,6-dioxo-4-(2-propylpyrazole-3-carbonyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-cyclopropylmethanone.
| Compound Name | [(4aR,7aS)-6,6-dioxo-4-(2-propylpyrazole-3-carbonyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-cyclopropylmethanone |
|---|---|
| PubChem CID | 70707893 |
| Molecular Formula | C17H24N4O4S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | [(4aR,7aS)-6,6-dioxo-4-(2-propylpyrazole-3-carbonyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-cyclopropylmethanone |
| SMILES | CCCn1nccc1C(=O)N1CCN(C(=O)C2CC2)[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C17H24N4O4S/c1-2-7-21-13(5-6-18-21)17(23)20-9-8-19(16(22)12-3-4-12)14-10-26(24,25)11-15(14)20/h5-6,12,14-15H,2-4,7-11H2,1H3/t14-,15+/m1/s1 |
| InChIKey | CLDUYSVSUUQESL-CABCVRRESA-N |
| XLogP | 0.15 |
| TPSA | 92.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |