About 1-[(1,3-dimethylpyrazol-4-yl)methyl]-8-(6-methyl-2-pyridinyl)-1,8-diazaspiro[4.5]decane
1-[(1,3-dimethylpyrazol-4-yl)methyl]-8-(6-methyl-2-pyridinyl)-1,8-diazaspiro[4.5]decane (PubChem CID 70707936) has the molecular formula C20H29N5
and a molecular weight of 339.49 g/mol. Its IUPAC name is 1-[(1,3-dimethylpyrazol-4-yl)methyl]-8-(6-methyl-2-pyridinyl)-1,8-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | 1-[(1,3-dimethylpyrazol-4-yl)methyl]-8-(6-methyl-2-pyridinyl)-1,8-diazaspiro[4.5]decane |
| PubChem CID | 70707936 |
| Molecular Formula | C20H29N5 |
| Molecular Weight | 339.49 g/mol |
| Exact Mass | 339.24 |
| IUPAC Name | 1-[(1,3-dimethylpyrazol-4-yl)methyl]-8-(6-methyl-2-pyridinyl)-1,8-diazaspiro[4.5]decane |
| SMILES | Cc1cccc(N2CCC3(CCCN3Cc3cn(C)nc3C)CC2)n1 |
| InChI | InChI=1S/C20H29N5/c1-16-6-4-7-19(21-16)24-12-9-20(10-13-24)8-5-11-25(20)15-18-14-23(3)22-17(18)2/h4,6-7,14H,5,8-13,15H2,1-3H3 |
| InChIKey | NKALJFDSRLJBIW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.49 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(1,3-dimethylpyrazol-4-yl)methyl]-8-(6-methyl-2-pyridinyl)-1,8-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1,3-dimethylpyrazol-4-yl)methyl]-8-(6-methyl-2-pyridinyl)-1,8-diazaspiro[4.5]decane?
The IUPAC name of 1-[(1,3-dimethylpyrazol-4-yl)methyl]-8-(6-methyl-2-pyridinyl)-1,8-diazaspiro[4.5]decane (CID 70707936) is 1-[(1,3-dimethylpyrazol-4-yl)methyl]-8-(6-methyl-2-pyridinyl)-1,8-diazaspiro[4.5]decane.
What is the SMILES notation for 1-[(1,3-dimethylpyrazol-4-yl)methyl]-8-(6-methyl-2-pyridinyl)-1,8-diazaspiro[4.5]decane?
The canonical SMILES for 1-[(1,3-dimethylpyrazol-4-yl)methyl]-8-(6-methyl-2-pyridinyl)-1,8-diazaspiro[4.5]decane is Cc1cccc(N2CCC3(CCCN3Cc3cn(C)nc3C)CC2)n1.
What is the InChIKey of 1-[(1,3-dimethylpyrazol-4-yl)methyl]-8-(6-methyl-2-pyridinyl)-1,8-diazaspiro[4.5]decane?
The InChIKey is NKALJFDSRLJBIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29N5/c1-16-6-4-7-19(21-16)24-12-9-20(10-13-24)8-5-11-25(20)15-18-14-23(3)22-17(18)2/h4,6-7,14H,5,8-13,15H2,1-3H3.
What are the key properties of 1-[(1,3-dimethylpyrazol-4-yl)methyl]-8-(6-methyl-2-pyridinyl)-1,8-diazaspiro[4.5]decane?
1-[(1,3-dimethylpyrazol-4-yl)methyl]-8-(6-methyl-2-pyridinyl)-1,8-diazaspiro[4.5]decane has a molecular weight of 339.49 g/mol, XLogP of 3.07, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1,3-dimethylpyrazol-4-yl)methyl]-8-(6-methyl-2-pyridinyl)-1,8-diazaspiro[4.5]decane is sourced from PubChem (CID 70707936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).