About 5-(3-fluorophenyl)-N,N-bis(2-methoxyethyl)-1H-pyrazole-4-carboxamide
5-(3-fluorophenyl)-N,N-bis(2-methoxyethyl)-1H-pyrazole-4-carboxamide (PubChem CID 70708292) has the molecular formula C16H20FN3O3
and a molecular weight of 321.35 g/mol. Its IUPAC name is 5-(3-fluorophenyl)-N,N-bis(2-methoxyethyl)-1H-pyrazole-4-carboxamide.
Molecular Properties
| Compound Name | 5-(3-fluorophenyl)-N,N-bis(2-methoxyethyl)-1H-pyrazole-4-carboxamide |
| PubChem CID | 70708292 |
| Molecular Formula | C16H20FN3O3 |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 5-(3-fluorophenyl)-N,N-bis(2-methoxyethyl)-1H-pyrazole-4-carboxamide |
| SMILES | COCCN(CCOC)C(=O)c1cn[nH]c1-c1cccc(F)c1 |
| InChI | InChI=1S/C16H20FN3O3/c1-22-8-6-20(7-9-23-2)16(21)14-11-18-19-15(14)12-4-3-5-13(17)10-12/h3-5,10-11H,6-9H2,1-2H3,(H,18,19) |
| InChIKey | MMQRDMUPSMCXTE-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(3-fluorophenyl)-N,N-bis(2-methoxyethyl)-1H-pyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-fluorophenyl)-N,N-bis(2-methoxyethyl)-1H-pyrazole-4-carboxamide?
The IUPAC name of 5-(3-fluorophenyl)-N,N-bis(2-methoxyethyl)-1H-pyrazole-4-carboxamide (CID 70708292) is 5-(3-fluorophenyl)-N,N-bis(2-methoxyethyl)-1H-pyrazole-4-carboxamide.
What is the SMILES notation for 5-(3-fluorophenyl)-N,N-bis(2-methoxyethyl)-1H-pyrazole-4-carboxamide?
The canonical SMILES for 5-(3-fluorophenyl)-N,N-bis(2-methoxyethyl)-1H-pyrazole-4-carboxamide is COCCN(CCOC)C(=O)c1cn[nH]c1-c1cccc(F)c1.
What is the InChIKey of 5-(3-fluorophenyl)-N,N-bis(2-methoxyethyl)-1H-pyrazole-4-carboxamide?
The InChIKey is MMQRDMUPSMCXTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20FN3O3/c1-22-8-6-20(7-9-23-2)16(21)14-11-18-19-15(14)12-4-3-5-13(17)10-12/h3-5,10-11H,6-9H2,1-2H3,(H,18,19).
What are the key properties of 5-(3-fluorophenyl)-N,N-bis(2-methoxyethyl)-1H-pyrazole-4-carboxamide?
5-(3-fluorophenyl)-N,N-bis(2-methoxyethyl)-1H-pyrazole-4-carboxamide has a molecular weight of 321.35 g/mol, XLogP of 1.95, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-fluorophenyl)-N,N-bis(2-methoxyethyl)-1H-pyrazole-4-carboxamide is sourced from PubChem (CID 70708292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).