C17H26N2O4S — CID 70709358
[(4aR,7aS)-1-(2-methylpropyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(2,5-dimethylfuran-3-yl)methanone (PubChem CID 70709358) has the molecular formula C17H26N2O4S and a molecular weight of 354.47 g/mol. Its IUPAC name is [(4aR,7aS)-1-(2-methylpropyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(2,5-dimethylfuran-3-yl)methanone.
| Compound Name | [(4aR,7aS)-1-(2-methylpropyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(2,5-dimethylfuran-3-yl)methanone |
|---|---|
| PubChem CID | 70709358 |
| Molecular Formula | C17H26N2O4S |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | [(4aR,7aS)-1-(2-methylpropyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(2,5-dimethylfuran-3-yl)methanone |
| SMILES | Cc1cc(C(=O)N2CCN(CC(C)C)[C@@H]3CS(=O)(=O)C[C@@H]32)c(C)o1 |
| InChI | InChI=1S/C17H26N2O4S/c1-11(2)8-18-5-6-19(16-10-24(21,22)9-15(16)18)17(20)14-7-12(3)23-13(14)4/h7,11,15-16H,5-6,8-10H2,1-4H3/t15-,16+/m1/s1 |
| InChIKey | PLOXFWQRIFJMIF-CVEARBPZSA-N |
| XLogP | 1.48 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |