C20H24N2O2 — CID 70709819
[(3aS,6aS)-3a-(hydroxymethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-(2,6-dimethylquinolin-4-yl)methanone (PubChem CID 70709819) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is [(3aS,6aS)-3a-(hydroxymethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-(2,6-dimethylquinolin-4-yl)methanone.
| Compound Name | [(3aS,6aS)-3a-(hydroxymethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-(2,6-dimethylquinolin-4-yl)methanone |
|---|---|
| PubChem CID | 70709819 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | [(3aS,6aS)-3a-(hydroxymethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-(2,6-dimethylquinolin-4-yl)methanone |
| SMILES | Cc1ccc2nc(C)cc(C(=O)N3C[C@H]4CCC[C@@]4(CO)C3)c2c1 |
| InChI | InChI=1S/C20H24N2O2/c1-13-5-6-18-16(8-13)17(9-14(2)21-18)19(24)22-10-15-4-3-7-20(15,11-22)12-23/h5-6,8-9,15,23H,3-4,7,10-12H2,1-2H3/t15-,20+/m1/s1 |
| InChIKey | JPMPPKICCYABPE-QRWLVFNGSA-N |
| XLogP | 3.09 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |