C21H23N5O — CID 70710877
6-[(4aS,8aR)-2-oxo-1-(2-pyridin-2-ylethyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-6-yl]pyridine-3-carbonitrile (PubChem CID 70710877) has the molecular formula C21H23N5O and a molecular weight of 361.45 g/mol. Its IUPAC name is 6-[(4aS,8aR)-2-oxo-1-(2-pyridin-2-ylethyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-6-yl]pyridine-3-carbonitrile.
| Compound Name | 6-[(4aS,8aR)-2-oxo-1-(2-pyridin-2-ylethyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-6-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 70710877 |
| Molecular Formula | C21H23N5O |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 6-[(4aS,8aR)-2-oxo-1-(2-pyridin-2-ylethyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-6-yl]pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(N2CC[C@@H]3[C@@H](CCC(=O)N3CCc3ccccn3)C2)nc1 |
| InChI | InChI=1S/C21H23N5O/c22-13-16-4-6-20(24-14-16)25-11-9-19-17(15-25)5-7-21(27)26(19)12-8-18-3-1-2-10-23-18/h1-4,6,10,14,17,19H,5,7-9,11-12,15H2/t17-,19+/m0/s1 |
| InChIKey | VETXWIJRZBLMGN-PKOBYXMFSA-N |
| XLogP | 2.41 |
| TPSA | 73.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |